Changes
DDT
,no edit summary
<p>In 1962, Houghton Mifflin published <em>Silent Spring</em> by American biologist Rachel Carson. The book catalogued the environmental impacts of the indiscriminate spraying of DDT in the US and questioned the logic of releasing large amounts of chemicals into the environment without fully understanding their effects on ecology or human health. The book suggested that DDT and other pesticides may cause cancer and that their agricultural use was a threat to wildlife, particularly birds.<sup class="reference" id="_ref-Silent_Spring_0">[3]</sup> The book resulted in a large public outcry that eventually led to DDT being banned in the US, and its publication was one of the signature events in the birth of the environmental movement. DDT was subsequently banned for agricultural use worldwide, but its limited use in disease vector control continues to this day in certain parts of the world and remains controversial.</p>
<p>Along with the passage of the Endangered Species Act, the US ban on DDT is cited by scientists as a major factor in the comeback of the bald eagle in the contiguous US.<sup class="reference" id="_ref-1">[4]</sup></p>
<p><a idtable class="Properties_and_chemistrytoccolours" style="CLEAR: right; FLOAT: right; MARGIN: 0px 0px 1em 1em; BORDER-COLLAPSE: collapse" width="250" border="1"> <tbody> <tr> <th style="BACKGROUND: #f8eaba; TEXT-ALIGN: center" colspan="2"><strong>DDT</strong></th> </tr> <tr> <td align="center" bgcolor="#ffffff" colspan="2"><img height="120" alt="" src="http://upload.wikimedia.org/wikipedia/commons/thumb/e/ed/DDT.svg/200px-DDT.svg.png" width="200" border="0" /></td> </tr> <tr> <td>IUPAC name</td> <td>4,4'-(2,2,2-trichloroethane-<br /> 1,1-diyl)bis(chlorobenzene)</td> </tr> <tr> <th style="BACKGROUND: #f8eaba; TEXT-ALIGN: center" colspan="2">Identifiers</th> </tr> <tr> <td>CAS number</td> <td><span class="reflink plainlinksneverexpand">50-29-3</span></td> </tr> <tr> <td>SMILES</td> <td><small><font size="Properties_and_chemistry2">Clc1ccc(cc1)C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl</font></small></td> </tr> <tr> <th style="BACKGROUND: #f8eaba; TEXT-ALIGN: center" colspan="2">Properties</th> </tr> <tr> <td>Molecular formula</td> <td>C<sub>14</sub>H<sub>9</sub>Cl<sub>5</sub></td> </tr> <tr> <td>Molar mass</td> <td>354.49 g/mol</td> </tr> <tr> <td>Density</td> <td>1.6 g/cm³</td> </tr> <tr> <td>Melting point</td> <td> <p>106.5 °C</p> </td> </tr> <tr> <td>Boiling point</td> <td> <p>260 °C</p> </td> </tr> <tr> <td style="BACKGROUND: #f8eaba; TEXT-ALIGN: center" colspan="2"><small><font size="2">Except where noted otherwise, data are given for<br /> materials in their </font><font size="2">standard state<br /> (at 25 °C, 100 kPa)</font><br /> <font size="2">Infobox disclaimer and references</font></small></td> </tr> </tbody></atable></p>
<h2><span class="editsection"></span><span class="mw-headline">Properties and chemistry</span></h2>
<p>DDT is an organochlorine insecticide, similar to the pesticides dicofol and methoxychlor. It is a highly hydrophobic, colorless, crystalline solid with a weak, chemical odor. It is nearly insoluble in water but has a good solubility in most organic solvents, fats, and oils.</p>